C14H24O5 — CID 14167476
tert-butyl (2S,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypent-4-enoate (PubChem CID 14167476) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypent-4-enoate.
| Compound Name | tert-butyl (2S,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypent-4-enoate |
|---|---|
| PubChem CID | 14167476 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | tert-butyl (2S,3R)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxypent-4-enoate |
| SMILES | C=C[C@H]([C@H](O)C(=O)OC(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C14H24O5/c1-7-9(10-8-17-14(5,6)18-10)11(15)12(16)19-13(2,3)4/h7,9-11,15H,1,8H2,2-6H3/t9-,10+,11-/m0/s1 |
| InChIKey | HXRCKGQDWYRPKO-AXFHLTTASA-N |
| XLogP | 1.64 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|