About 2-(7,7-dimethyl-3-oxatricyclo[4.1.1.02,4]octan-2-yl)ethanol
2-(7,7-dimethyl-3-oxatricyclo[4.1.1.02,4]octan-2-yl)ethanol (PubChem CID 14167481) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 2-(7,7-dimethyl-3-oxatricyclo[4.1.1.02,4]octan-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-(7,7-dimethyl-3-oxatricyclo[4.1.1.02,4]octan-2-yl)ethanol |
| PubChem CID | 14167481 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 2-(7,7-dimethyl-3-oxatricyclo[4.1.1.02,4]octan-2-yl)ethanol |
| SMILES | CC1(C)C2CC3OC3(CCO)C1C2 |
| InChI | InChI=1S/C11H18O2/c1-10(2)7-5-8(10)11(3-4-12)9(6-7)13-11/h7-9,12H,3-6H2,1-2H3 |
| InChIKey | NDIGBWKWJKUVPV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(7,7-dimethyl-3-oxatricyclo[4.1.1.02,4]octan-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7,7-dimethyl-3-oxatricyclo[4.1.1.02,4]octan-2-yl)ethanol?
The IUPAC name of 2-(7,7-dimethyl-3-oxatricyclo[4.1.1.02,4]octan-2-yl)ethanol (CID 14167481) is 2-(7,7-dimethyl-3-oxatricyclo[4.1.1.02,4]octan-2-yl)ethanol.
What is the SMILES notation for 2-(7,7-dimethyl-3-oxatricyclo[4.1.1.02,4]octan-2-yl)ethanol?
The canonical SMILES for 2-(7,7-dimethyl-3-oxatricyclo[4.1.1.02,4]octan-2-yl)ethanol is CC1(C)C2CC3OC3(CCO)C1C2.
What is the InChIKey of 2-(7,7-dimethyl-3-oxatricyclo[4.1.1.02,4]octan-2-yl)ethanol?
The InChIKey is NDIGBWKWJKUVPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-10(2)7-5-8(10)11(3-4-12)9(6-7)13-11/h7-9,12H,3-6H2,1-2H3.
What are the key properties of 2-(7,7-dimethyl-3-oxatricyclo[4.1.1.02,4]octan-2-yl)ethanol?
2-(7,7-dimethyl-3-oxatricyclo[4.1.1.02,4]octan-2-yl)ethanol has a molecular weight of 182.26 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7,7-dimethyl-3-oxatricyclo[4.1.1.02,4]octan-2-yl)ethanol is sourced from PubChem (CID 14167481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).