C20H34O3 — CID 14167673
[3-ethenyl-3-(hydroxymethyl)-4a,7,10a-trimethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-7-yl]methanol (PubChem CID 14167673) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is [3-ethenyl-3-(hydroxymethyl)-4a,7,10a-trimethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-7-yl]methanol.
| Compound Name | [3-ethenyl-3-(hydroxymethyl)-4a,7,10a-trimethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-7-yl]methanol |
|---|---|
| PubChem CID | 14167673 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | [3-ethenyl-3-(hydroxymethyl)-4a,7,10a-trimethyl-2,5,6,6a,8,9,10,10b-octahydro-1H-benzo[f]chromen-7-yl]methanol |
| SMILES | C=CC1(CO)CCC2C(C)(CCC3C(C)(CO)CCCC32C)O1 |
| InChI | InChI=1S/C20H34O3/c1-5-20(14-22)12-8-16-18(3)10-6-9-17(2,13-21)15(18)7-11-19(16,4)23-20/h5,15-16,21-22H,1,6-14H2,2-4H3 |
| InChIKey | SCVQZSIEFMYHAN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|