About N-[3-(2,5-dimethoxyanilino)quinoxalin-2-yl]-4-fluorobenzenesulfonamide
N-[3-(2,5-dimethoxyanilino)quinoxalin-2-yl]-4-fluorobenzenesulfonamide (PubChem CID 1416843) has the molecular formula C22H19FN4O4S
and a molecular weight of 454.48 g/mol. Its IUPAC name is N-[3-(2,5-dimethoxyanilino)quinoxalin-2-yl]-4-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | N-[3-(2,5-dimethoxyanilino)quinoxalin-2-yl]-4-fluorobenzenesulfonamide |
| PubChem CID | 1416843 |
| Molecular Formula | C22H19FN4O4S |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | N-[3-(2,5-dimethoxyanilino)quinoxalin-2-yl]-4-fluorobenzenesulfonamide |
| SMILES | COc1ccc(OC)c(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H19FN4O4S/c1-30-15-9-12-20(31-2)19(13-15)26-21-22(25-18-6-4-3-5-17(18)24-21)27-32(28,29)16-10-7-14(23)8-11-16/h3-13H,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | JPEFDJOHLPERCB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[3-(2,5-dimethoxyanilino)quinoxalin-2-yl]-4-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2,5-dimethoxyanilino)quinoxalin-2-yl]-4-fluorobenzenesulfonamide?
The IUPAC name of N-[3-(2,5-dimethoxyanilino)quinoxalin-2-yl]-4-fluorobenzenesulfonamide (CID 1416843) is N-[3-(2,5-dimethoxyanilino)quinoxalin-2-yl]-4-fluorobenzenesulfonamide.
What is the SMILES notation for N-[3-(2,5-dimethoxyanilino)quinoxalin-2-yl]-4-fluorobenzenesulfonamide?
The canonical SMILES for N-[3-(2,5-dimethoxyanilino)quinoxalin-2-yl]-4-fluorobenzenesulfonamide is COc1ccc(OC)c(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccc(F)cc2)c1.
What is the InChIKey of N-[3-(2,5-dimethoxyanilino)quinoxalin-2-yl]-4-fluorobenzenesulfonamide?
The InChIKey is JPEFDJOHLPERCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19FN4O4S/c1-30-15-9-12-20(31-2)19(13-15)26-21-22(25-18-6-4-3-5-17(18)24-21)27-32(28,29)16-10-7-14(23)8-11-16/h3-13H,1-2H3,(H,24,26)(H,25,27).
What are the key properties of N-[3-(2,5-dimethoxyanilino)quinoxalin-2-yl]-4-fluorobenzenesulfonamide?
N-[3-(2,5-dimethoxyanilino)quinoxalin-2-yl]-4-fluorobenzenesulfonamide has a molecular weight of 454.48 g/mol, XLogP of 4.33, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2,5-dimethoxyanilino)quinoxalin-2-yl]-4-fluorobenzenesulfonamide is sourced from PubChem (CID 1416843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).