2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one

C7H6Cl2O2 — CID 14169626

IUPAC2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one
SMILESO=C1C(Cl)C2C=CC(O2)C1Cl
InChIInChI=1S/C7H6Cl2O2/c8-5-3-1-2-4(11-3)6(9)7(5)10/h1-6H
InChIKeyWTVPZDGBOGCTJF-UHFFFAOYSA-N
MW193.03 g/mol
LogP1.11
Rot. Bonds

About 2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one

2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 14169626) has the molecular formula C7H6Cl2O2 and a molecular weight of 193.03 g/mol. Its IUPAC name is 2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one.

Molecular Properties

Compound Name2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one
PubChem CID14169626
Molecular FormulaC7H6Cl2O2
Molecular Weight193.03 g/mol
Exact Mass191.97
IUPAC Name2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one
SMILESO=C1C(Cl)C2C=CC(O2)C1Cl
InChIInChI=1S/C7H6Cl2O2/c8-5-3-1-2-4(11-3)6(9)7(5)10/h1-6H
InChIKeyWTVPZDGBOGCTJF-UHFFFAOYSA-N
XLogP1.11
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.03
LogP ≤ 51.11
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

CID 10890662
CID 10890662
CID 21579881
CID 21579881
CID 134887637
CID 134887637
CID 641120
CID 641120
CID 11608152
CID 11608152
CID 130763734
CID 130763734
CID 2755126
CID 2755126
CID 2755349
CID 2755349
CID 5248147
CID 5248147
CID 7057464
CID 7057464
CID 7057465
CID 7057465
CID 12922081
CID 12922081

Frequently Asked Questions

What is the IUPAC name of 2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one?
The IUPAC name of 2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one (CID 14169626) is 2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one.
What is the SMILES notation for 2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one?
The canonical SMILES for 2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one is O=C1C(Cl)C2C=CC(O2)C1Cl.
What is the InChIKey of 2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one?
The InChIKey is WTVPZDGBOGCTJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2O2/c8-5-3-1-2-4(11-3)6(9)7(5)10/h1-6H.
What are the key properties of 2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one?
2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one has a molecular weight of 193.03 g/mol, XLogP of 1.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-8-oxabicyclo[3.2.1]oct-6-en-3-one is sourced from PubChem (CID 14169626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).