C30H20Br4N2 — CID 14169684
1-N,1-N,4-N,4-N-tetrakis(4-bromophenyl)benzene-1,4-diamine (PubChem CID 14169684) has the molecular formula C30H20Br4N2 and a molecular weight of 728.12 g/mol. Its IUPAC name is 1-N,1-N,4-N,4-N-tetrakis(4-bromophenyl)benzene-1,4-diamine.
| Compound Name | 1-N,1-N,4-N,4-N-tetrakis(4-bromophenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 14169684 |
| Molecular Formula | C30H20Br4N2 |
| Molecular Weight | 728.12 g/mol |
| Exact Mass | 723.84 |
| IUPAC Name | 1-N,1-N,4-N,4-N-tetrakis(4-bromophenyl)benzene-1,4-diamine |
| SMILES | Brc1ccc(N(c2ccc(Br)cc2)c2ccc(N(c3ccc(Br)cc3)c3ccc(Br)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H20Br4N2/c31-21-1-9-25(10-2-21)35(26-11-3-22(32)4-12-26)29-17-19-30(20-18-29)36(27-13-5-23(33)6-14-27)28-15-7-24(34)8-16-28/h1-20H |
| InChIKey | VBQLPFDITKJLJZ-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.12 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |