About 2,3-bis-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate
2,3-bis-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate (PubChem CID 14169769) has the molecular formula C24H26O9S3
and a molecular weight of 554.66 g/mol. Its IUPAC name is 2,3-bis-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 2,3-bis-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate |
| PubChem CID | 14169769 |
| Molecular Formula | C24H26O9S3 |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 554.07 |
| IUPAC Name | 2,3-bis-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(COS(=O)(=O)c2ccc(C)cc2)OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H26O9S3/c1-18-4-10-22(11-5-18)34(25,26)31-16-21(33-36(29,30)24-14-8-20(3)9-15-24)17-32-35(27,28)23-12-6-19(2)7-13-23/h4-15,21H,16-17H2,1-3H3 |
| InChIKey | LKVLBWWYOFMVLH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate?
The IUPAC name of 2,3-bis-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate (CID 14169769) is 2,3-bis-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate.
What is the SMILES notation for 2,3-bis-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate?
The canonical SMILES for 2,3-bis-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC(COS(=O)(=O)c2ccc(C)cc2)OS(=O)(=O)c2ccc(C)cc2)cc1.
What is the InChIKey of 2,3-bis-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate?
The InChIKey is LKVLBWWYOFMVLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26O9S3/c1-18-4-10-22(11-5-18)34(25,26)31-16-21(33-36(29,30)24-14-8-20(3)9-15-24)17-32-35(27,28)23-12-6-19(2)7-13-23/h4-15,21H,16-17H2,1-3H3.
What are the key properties of 2,3-bis-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate?
2,3-bis-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate has a molecular weight of 554.66 g/mol, XLogP of 3.50, 11 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis-(4-methylphenyl)sulfonyloxypropyl 4-methylbenzenesulfonate is sourced from PubChem (CID 14169769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).