About [(3R)-hept-1-en-3-yl] methyl carbonate
[(3R)-hept-1-en-3-yl] methyl carbonate (PubChem CID 14170339) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is [(3R)-hept-1-en-3-yl] methyl carbonate.
Molecular Properties
| Compound Name | [(3R)-hept-1-en-3-yl] methyl carbonate |
| PubChem CID | 14170339 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | [(3R)-hept-1-en-3-yl] methyl carbonate |
| SMILES | C=C[C@@H](CCCC)OC(=O)OC |
| InChI | InChI=1S/C9H16O3/c1-4-6-7-8(5-2)12-9(10)11-3/h5,8H,2,4,6-7H2,1,3H3/t8-/m0/s1 |
| InChIKey | RQOGIYJFHUTLAU-QMMMGPOBSA-N |
| XLogP | 2.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-hept-1-en-3-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-hept-1-en-3-yl] methyl carbonate?
The IUPAC name of [(3R)-hept-1-en-3-yl] methyl carbonate (CID 14170339) is [(3R)-hept-1-en-3-yl] methyl carbonate.
What is the SMILES notation for [(3R)-hept-1-en-3-yl] methyl carbonate?
The canonical SMILES for [(3R)-hept-1-en-3-yl] methyl carbonate is C=C[C@@H](CCCC)OC(=O)OC.
What is the InChIKey of [(3R)-hept-1-en-3-yl] methyl carbonate?
The InChIKey is RQOGIYJFHUTLAU-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H16O3/c1-4-6-7-8(5-2)12-9(10)11-3/h5,8H,2,4,6-7H2,1,3H3/t8-/m0/s1.
What are the key properties of [(3R)-hept-1-en-3-yl] methyl carbonate?
[(3R)-hept-1-en-3-yl] methyl carbonate has a molecular weight of 172.22 g/mol, XLogP of 2.51, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-hept-1-en-3-yl] methyl carbonate is sourced from PubChem (CID 14170339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).