About N-benzyl-N-(2,4-dichlorophenyl)formamide
N-benzyl-N-(2,4-dichlorophenyl)formamide (PubChem CID 14170852) has the molecular formula C14H11Cl2NO
and a molecular weight of 280.15 g/mol. Its IUPAC name is N-benzyl-N-(2,4-dichlorophenyl)formamide.
Molecular Properties
| Compound Name | N-benzyl-N-(2,4-dichlorophenyl)formamide |
| PubChem CID | 14170852 |
| Molecular Formula | C14H11Cl2NO |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | N-benzyl-N-(2,4-dichlorophenyl)formamide |
| SMILES | O=CN(Cc1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl2NO/c15-12-6-7-14(13(16)8-12)17(10-18)9-11-4-2-1-3-5-11/h1-8,10H,9H2 |
| InChIKey | DZYIWAOHNGYFIW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N-(2,4-dichlorophenyl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-(2,4-dichlorophenyl)formamide?
The IUPAC name of N-benzyl-N-(2,4-dichlorophenyl)formamide (CID 14170852) is N-benzyl-N-(2,4-dichlorophenyl)formamide.
What is the SMILES notation for N-benzyl-N-(2,4-dichlorophenyl)formamide?
The canonical SMILES for N-benzyl-N-(2,4-dichlorophenyl)formamide is O=CN(Cc1ccccc1)c1ccc(Cl)cc1Cl.
What is the InChIKey of N-benzyl-N-(2,4-dichlorophenyl)formamide?
The InChIKey is DZYIWAOHNGYFIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Cl2NO/c15-12-6-7-14(13(16)8-12)17(10-18)9-11-4-2-1-3-5-11/h1-8,10H,9H2.
What are the key properties of N-benzyl-N-(2,4-dichlorophenyl)formamide?
N-benzyl-N-(2,4-dichlorophenyl)formamide has a molecular weight of 280.15 g/mol, XLogP of 4.16, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-(2,4-dichlorophenyl)formamide is sourced from PubChem (CID 14170852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).