C8H13N3O2S — CID 14171364
ethyl 3-amino-5-(ethylamino)-1,2-thiazole-4-carboxylate (PubChem CID 14171364) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is ethyl 3-amino-5-(ethylamino)-1,2-thiazole-4-carboxylate.
| Compound Name | ethyl 3-amino-5-(ethylamino)-1,2-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 14171364 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | ethyl 3-amino-5-(ethylamino)-1,2-thiazole-4-carboxylate |
| SMILES | CCNc1snc(N)c1C(=O)OCC |
| InChI | InChI=1S/C8H13N3O2S/c1-3-10-7-5(6(9)11-14-7)8(12)13-4-2/h10H,3-4H2,1-2H3,(H2,9,11) |
| InChIKey | DNSQBNPDOACBBT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |