About 3-amino-5-anilino-1,2-thiazole-4-carbonitrile
3-amino-5-anilino-1,2-thiazole-4-carbonitrile (PubChem CID 14171368) has the molecular formula C10H8N4S
and a molecular weight of 216.27 g/mol. Its IUPAC name is 3-amino-5-anilino-1,2-thiazole-4-carbonitrile.
Molecular Properties
| Compound Name | 3-amino-5-anilino-1,2-thiazole-4-carbonitrile |
| PubChem CID | 14171368 |
| Molecular Formula | C10H8N4S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 3-amino-5-anilino-1,2-thiazole-4-carbonitrile |
| SMILES | N#Cc1c(N)nsc1Nc1ccccc1 |
| InChI | InChI=1S/C10H8N4S/c11-6-8-9(12)14-15-10(8)13-7-4-2-1-3-5-7/h1-5,13H,(H2,12,14) |
| InChIKey | WELCWRQPHDYPND-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-5-anilino-1,2-thiazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-anilino-1,2-thiazole-4-carbonitrile?
The IUPAC name of 3-amino-5-anilino-1,2-thiazole-4-carbonitrile (CID 14171368) is 3-amino-5-anilino-1,2-thiazole-4-carbonitrile.
What is the SMILES notation for 3-amino-5-anilino-1,2-thiazole-4-carbonitrile?
The canonical SMILES for 3-amino-5-anilino-1,2-thiazole-4-carbonitrile is N#Cc1c(N)nsc1Nc1ccccc1.
What is the InChIKey of 3-amino-5-anilino-1,2-thiazole-4-carbonitrile?
The InChIKey is WELCWRQPHDYPND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4S/c11-6-8-9(12)14-15-10(8)13-7-4-2-1-3-5-7/h1-5,13H,(H2,12,14).
What are the key properties of 3-amino-5-anilino-1,2-thiazole-4-carbonitrile?
3-amino-5-anilino-1,2-thiazole-4-carbonitrile has a molecular weight of 216.27 g/mol, XLogP of 2.34, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-anilino-1,2-thiazole-4-carbonitrile is sourced from PubChem (CID 14171368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).