About tert-butyl 3-amino-5-anilino-1,2-thiazole-4-carboxylate
tert-butyl 3-amino-5-anilino-1,2-thiazole-4-carboxylate (PubChem CID 14171371) has the molecular formula C14H17N3O2S
and a molecular weight of 291.38 g/mol. Its IUPAC name is tert-butyl 3-amino-5-anilino-1,2-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-amino-5-anilino-1,2-thiazole-4-carboxylate |
| PubChem CID | 14171371 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | tert-butyl 3-amino-5-anilino-1,2-thiazole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1c(N)nsc1Nc1ccccc1 |
| InChI | InChI=1S/C14H17N3O2S/c1-14(2,3)19-13(18)10-11(15)17-20-12(10)16-9-7-5-4-6-8-9/h4-8,16H,1-3H3,(H2,15,17) |
| InChIKey | RPQXNXABKURCSC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 3-amino-5-anilino-1,2-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-amino-5-anilino-1,2-thiazole-4-carboxylate?
The IUPAC name of tert-butyl 3-amino-5-anilino-1,2-thiazole-4-carboxylate (CID 14171371) is tert-butyl 3-amino-5-anilino-1,2-thiazole-4-carboxylate.
What is the SMILES notation for tert-butyl 3-amino-5-anilino-1,2-thiazole-4-carboxylate?
The canonical SMILES for tert-butyl 3-amino-5-anilino-1,2-thiazole-4-carboxylate is CC(C)(C)OC(=O)c1c(N)nsc1Nc1ccccc1.
What is the InChIKey of tert-butyl 3-amino-5-anilino-1,2-thiazole-4-carboxylate?
The InChIKey is RPQXNXABKURCSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2S/c1-14(2,3)19-13(18)10-11(15)17-20-12(10)16-9-7-5-4-6-8-9/h4-8,16H,1-3H3,(H2,15,17).
What are the key properties of tert-butyl 3-amino-5-anilino-1,2-thiazole-4-carboxylate?
tert-butyl 3-amino-5-anilino-1,2-thiazole-4-carboxylate has a molecular weight of 291.38 g/mol, XLogP of 3.42, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-amino-5-anilino-1,2-thiazole-4-carboxylate is sourced from PubChem (CID 14171371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).