About ethyl 3-amino-5-[3-(trifluoromethyl)anilino]-1,2-thiazole-4-carboxylate
ethyl 3-amino-5-[3-(trifluoromethyl)anilino]-1,2-thiazole-4-carboxylate (PubChem CID 14171378) has the molecular formula C13H12F3N3O2S
and a molecular weight of 331.32 g/mol. Its IUPAC name is ethyl 3-amino-5-[3-(trifluoromethyl)anilino]-1,2-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-amino-5-[3-(trifluoromethyl)anilino]-1,2-thiazole-4-carboxylate |
| PubChem CID | 14171378 |
| Molecular Formula | C13H12F3N3O2S |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | ethyl 3-amino-5-[3-(trifluoromethyl)anilino]-1,2-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(N)nsc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F3N3O2S/c1-2-21-12(20)9-10(17)19-22-11(9)18-8-5-3-4-7(6-8)13(14,15)16/h3-6,18H,2H2,1H3,(H2,17,19) |
| InChIKey | OIAMAHLXMQWRDD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-amino-5-[3-(trifluoromethyl)anilino]-1,2-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-amino-5-[3-(trifluoromethyl)anilino]-1,2-thiazole-4-carboxylate?
The IUPAC name of ethyl 3-amino-5-[3-(trifluoromethyl)anilino]-1,2-thiazole-4-carboxylate (CID 14171378) is ethyl 3-amino-5-[3-(trifluoromethyl)anilino]-1,2-thiazole-4-carboxylate.
What is the SMILES notation for ethyl 3-amino-5-[3-(trifluoromethyl)anilino]-1,2-thiazole-4-carboxylate?
The canonical SMILES for ethyl 3-amino-5-[3-(trifluoromethyl)anilino]-1,2-thiazole-4-carboxylate is CCOC(=O)c1c(N)nsc1Nc1cccc(C(F)(F)F)c1.
What is the InChIKey of ethyl 3-amino-5-[3-(trifluoromethyl)anilino]-1,2-thiazole-4-carboxylate?
The InChIKey is OIAMAHLXMQWRDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3N3O2S/c1-2-21-12(20)9-10(17)19-22-11(9)18-8-5-3-4-7(6-8)13(14,15)16/h3-6,18H,2H2,1H3,(H2,17,19).
What are the key properties of ethyl 3-amino-5-[3-(trifluoromethyl)anilino]-1,2-thiazole-4-carboxylate?
ethyl 3-amino-5-[3-(trifluoromethyl)anilino]-1,2-thiazole-4-carboxylate has a molecular weight of 331.32 g/mol, XLogP of 3.66, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-amino-5-[3-(trifluoromethyl)anilino]-1,2-thiazole-4-carboxylate is sourced from PubChem (CID 14171378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).