C18H16N2O2 — CID 14171658
(3aS,7aR)-2-(3-aminonaphthalen-2-yl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 14171658) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is (3aS,7aR)-2-(3-aminonaphthalen-2-yl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aR)-2-(3-aminonaphthalen-2-yl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 14171658 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (3aS,7aR)-2-(3-aminonaphthalen-2-yl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | Nc1cc2ccccc2cc1N1C(=O)[C@H]2CC=CC[C@H]2C1=O |
| InChI | InChI=1S/C18H16N2O2/c19-15-9-11-5-1-2-6-12(11)10-16(15)20-17(21)13-7-3-4-8-14(13)18(20)22/h1-6,9-10,13-14H,7-8,19H2/t13-,14+ |
| InChIKey | VJDRXTDASKLMDP-OKILXGFUSA-N |
| XLogP | 2.88 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|