About 4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one
4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one (PubChem CID 14172320) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one.
Molecular Properties
| Compound Name | 4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one |
| PubChem CID | 14172320 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)OOC1(C)C=CC(=O)C=C1 |
| InChI | InChI=1S/C11H16O3/c1-10(2,3)13-14-11(4)7-5-9(12)6-8-11/h5-8H,1-4H3 |
| InChIKey | PZTUGPLBFDQACO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one?
The IUPAC name of 4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one (CID 14172320) is 4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one.
What is the SMILES notation for 4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one?
The canonical SMILES for 4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one is CC(C)(C)OOC1(C)C=CC(=O)C=C1.
What is the InChIKey of 4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one?
The InChIKey is PZTUGPLBFDQACO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-10(2,3)13-14-11(4)7-5-9(12)6-8-11/h5-8H,1-4H3.
What are the key properties of 4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one?
4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one has a molecular weight of 196.25 g/mol, XLogP of 2.19, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butylperoxy-4-methylcyclohexa-2,5-dien-1-one is sourced from PubChem (CID 14172320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).