C7F15NO3S — CID 14172430
1,1,2,2,3,3-hexafluoro-3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)propane-1-sulfonyl fluoride (PubChem CID 14172430) has the molecular formula C7F15NO3S and a molecular weight of 463.12 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)propane-1-sulfonyl fluoride.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)propane-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 14172430 |
| Molecular Formula | C7F15NO3S |
| Molecular Weight | 463.12 g/mol |
| Exact Mass | 462.94 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)propane-1-sulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)C(F)(F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C7F15NO3S/c8-1(9,7(20,21)27(22,24)25)2(10,11)23-3(12,13)5(16,17)26-6(18,19)4(23,14)15 |
| InChIKey | ZWHPCHRSYMPCSB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.12 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|