About 5-ethylidene-1,2,3,4-tetramethylcyclopenta-1,3-diene
5-ethylidene-1,2,3,4-tetramethylcyclopenta-1,3-diene (PubChem CID 14172469) has the molecular formula C11H16
and a molecular weight of 148.25 g/mol. Its IUPAC name is 5-ethylidene-1,2,3,4-tetramethylcyclopenta-1,3-diene.
Analyze 5-ethylidene-1,2,3,4-tetramethylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylidene-1,2,3,4-tetramethylcyclopenta-1,3-diene?
The IUPAC name of 5-ethylidene-1,2,3,4-tetramethylcyclopenta-1,3-diene (CID 14172469) is 5-ethylidene-1,2,3,4-tetramethylcyclopenta-1,3-diene.
What is the SMILES notation for 5-ethylidene-1,2,3,4-tetramethylcyclopenta-1,3-diene?
The canonical SMILES for 5-ethylidene-1,2,3,4-tetramethylcyclopenta-1,3-diene is CC=C1C(C)=C(C)C(C)=C1C.
What is the InChIKey of 5-ethylidene-1,2,3,4-tetramethylcyclopenta-1,3-diene?
The InChIKey is GMXJULBTMDZPHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16/c1-6-11-9(4)7(2)8(3)10(11)5/h6H,1-5H3.
What are the key properties of 5-ethylidene-1,2,3,4-tetramethylcyclopenta-1,3-diene?
5-ethylidene-1,2,3,4-tetramethylcyclopenta-1,3-diene has a molecular weight of 148.25 g/mol, XLogP of 3.62, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylidene-1,2,3,4-tetramethylcyclopenta-1,3-diene is sourced from PubChem (CID 14172469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).