C12H12N2O2 — CID 14173156
(3aR,6aR)-6-hydroxy-3a,6a-dimethyl-3-oxo-2,4-dihydro-1H-pentalene-2,5-dicarbonitrile (PubChem CID 14173156) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is (3aR,6aR)-6-hydroxy-3a,6a-dimethyl-3-oxo-2,4-dihydro-1H-pentalene-2,5-dicarbonitrile.
| Compound Name | (3aR,6aR)-6-hydroxy-3a,6a-dimethyl-3-oxo-2,4-dihydro-1H-pentalene-2,5-dicarbonitrile |
|---|---|
| PubChem CID | 14173156 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | (3aR,6aR)-6-hydroxy-3a,6a-dimethyl-3-oxo-2,4-dihydro-1H-pentalene-2,5-dicarbonitrile |
| SMILES | C[C@@]12CC(C#N)=C(O)[C@]1(C)CC(C#N)C2=O |
| InChI | InChI=1S/C12H12N2O2/c1-11-3-7(5-13)10(16)12(11,2)4-8(6-14)9(11)15/h7,15H,3-4H2,1-2H3/t7?,11-,12-/m0/s1 |
| InChIKey | IUWXZVAJLVDKRA-JCADVYKZSA-N |
| XLogP | 1.85 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|