About 5-phenylsulfanyl-1,4-dihydronaphthalene
5-phenylsulfanyl-1,4-dihydronaphthalene (PubChem CID 14173374) has the molecular formula C16H14S
and a molecular weight of 238.36 g/mol. Its IUPAC name is 5-phenylsulfanyl-1,4-dihydronaphthalene.
Molecular Properties
| Compound Name | 5-phenylsulfanyl-1,4-dihydronaphthalene |
| PubChem CID | 14173374 |
| Molecular Formula | C16H14S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 5-phenylsulfanyl-1,4-dihydronaphthalene |
| SMILES | C1=CCc2c(cccc2Sc2ccccc2)C1 |
| InChI | InChI=1S/C16H14S/c1-2-9-14(10-3-1)17-16-12-6-8-13-7-4-5-11-15(13)16/h1-6,8-10,12H,7,11H2 |
| InChIKey | SECJZWAQKMJTSE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-phenylsulfanyl-1,4-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylsulfanyl-1,4-dihydronaphthalene?
The IUPAC name of 5-phenylsulfanyl-1,4-dihydronaphthalene (CID 14173374) is 5-phenylsulfanyl-1,4-dihydronaphthalene.
What is the SMILES notation for 5-phenylsulfanyl-1,4-dihydronaphthalene?
The canonical SMILES for 5-phenylsulfanyl-1,4-dihydronaphthalene is C1=CCc2c(cccc2Sc2ccccc2)C1.
What is the InChIKey of 5-phenylsulfanyl-1,4-dihydronaphthalene?
The InChIKey is SECJZWAQKMJTSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14S/c1-2-9-14(10-3-1)17-16-12-6-8-13-7-4-5-11-15(13)16/h1-6,8-10,12H,7,11H2.
What are the key properties of 5-phenylsulfanyl-1,4-dihydronaphthalene?
5-phenylsulfanyl-1,4-dihydronaphthalene has a molecular weight of 238.36 g/mol, XLogP of 4.49, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylsulfanyl-1,4-dihydronaphthalene is sourced from PubChem (CID 14173374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).