C17H10S3 — CID 14173520
4-phenylthiopyrano[3,2-b][1]benzothiole-2-thione (PubChem CID 14173520) has the molecular formula C17H10S3 and a molecular weight of 310.47 g/mol. Its IUPAC name is 4-phenylthiopyrano[3,2-b][1]benzothiole-2-thione.
| Compound Name | 4-phenylthiopyrano[3,2-b][1]benzothiole-2-thione |
|---|---|
| PubChem CID | 14173520 |
| Molecular Formula | C17H10S3 |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 4-phenylthiopyrano[3,2-b][1]benzothiole-2-thione |
| SMILES | S=c1cc(-c2ccccc2)c2sc3ccccc3c2s1 |
| InChI | InChI=1S/C17H10S3/c18-15-10-13(11-6-2-1-3-7-11)17-16(20-15)12-8-4-5-9-14(12)19-17/h1-10H |
| InChIKey | GRXHYFWGNORNTI-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|