C12H16ClN3O2 — CID 14173554
3-[(2-chlorobenzoyl)amino]-1,1-diethylurea (PubChem CID 14173554) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is 3-[(2-chlorobenzoyl)amino]-1,1-diethylurea.
| Compound Name | 3-[(2-chlorobenzoyl)amino]-1,1-diethylurea |
|---|---|
| PubChem CID | 14173554 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 3-[(2-chlorobenzoyl)amino]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C12H16ClN3O2/c1-3-16(4-2)12(18)15-14-11(17)9-7-5-6-8-10(9)13/h5-8H,3-4H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | XWBVWHDKWRGQOC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|