C8H14O3 — CID 14174444
2-[(4R,6R)-4,6-dimethyl-1,3-dioxan-2-yl]acetaldehyde (PubChem CID 14174444) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-[(4R,6R)-4,6-dimethyl-1,3-dioxan-2-yl]acetaldehyde.
| Compound Name | 2-[(4R,6R)-4,6-dimethyl-1,3-dioxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 14174444 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 2-[(4R,6R)-4,6-dimethyl-1,3-dioxan-2-yl]acetaldehyde |
| SMILES | C[C@@H]1C[C@@H](C)OC(CC=O)O1 |
| InChI | InChI=1S/C8H14O3/c1-6-5-7(2)11-8(10-6)3-4-9/h4,6-8H,3,5H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | GQSCMHOLEVGSKS-RNFRBKRXSA-N |
| XLogP | 1.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|