About N-cyanooctanamide
N-cyanooctanamide (PubChem CID 14174696) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is N-cyanooctanamide.
Molecular Properties
| Compound Name | N-cyanooctanamide |
| PubChem CID | 14174696 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | N-cyanooctanamide |
| SMILES | CCCCCCCC(=O)NC#N |
| InChI | InChI=1S/C9H16N2O/c1-2-3-4-5-6-7-9(12)11-8-10/h2-7H2,1H3,(H,11,12) |
| InChIKey | YVIHXJATWKTJBI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze N-cyanooctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyanooctanamide?
The IUPAC name of N-cyanooctanamide (CID 14174696) is N-cyanooctanamide.
What is the SMILES notation for N-cyanooctanamide?
The canonical SMILES for N-cyanooctanamide is CCCCCCCC(=O)NC#N.
What is the InChIKey of N-cyanooctanamide?
The InChIKey is YVIHXJATWKTJBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c1-2-3-4-5-6-7-9(12)11-8-10/h2-7H2,1H3,(H,11,12).
What are the key properties of N-cyanooctanamide?
N-cyanooctanamide has a molecular weight of 168.24 g/mol, XLogP of 1.94, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyanooctanamide is sourced from PubChem (CID 14174696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).