About 2,7-dimethoxy-2,7-dimethylocta-3,5-diyne
2,7-dimethoxy-2,7-dimethylocta-3,5-diyne (PubChem CID 14175237) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is 2,7-dimethoxy-2,7-dimethylocta-3,5-diyne.
Molecular Properties
| Compound Name | 2,7-dimethoxy-2,7-dimethylocta-3,5-diyne |
| PubChem CID | 14175237 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2,7-dimethoxy-2,7-dimethylocta-3,5-diyne |
| SMILES | COC(C)(C)C#CC#CC(C)(C)OC |
| InChI | InChI=1S/C12H18O2/c1-11(2,13-5)9-7-8-10-12(3,4)14-6/h1-6H3 |
| InChIKey | GHNXJCHGTBSHLV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dimethoxy-2,7-dimethylocta-3,5-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethoxy-2,7-dimethylocta-3,5-diyne?
The IUPAC name of 2,7-dimethoxy-2,7-dimethylocta-3,5-diyne (CID 14175237) is 2,7-dimethoxy-2,7-dimethylocta-3,5-diyne.
What is the SMILES notation for 2,7-dimethoxy-2,7-dimethylocta-3,5-diyne?
The canonical SMILES for 2,7-dimethoxy-2,7-dimethylocta-3,5-diyne is COC(C)(C)C#CC#CC(C)(C)OC.
What is the InChIKey of 2,7-dimethoxy-2,7-dimethylocta-3,5-diyne?
The InChIKey is GHNXJCHGTBSHLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c1-11(2,13-5)9-7-8-10-12(3,4)14-6/h1-6H3.
What are the key properties of 2,7-dimethoxy-2,7-dimethylocta-3,5-diyne?
2,7-dimethoxy-2,7-dimethylocta-3,5-diyne has a molecular weight of 194.27 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethoxy-2,7-dimethylocta-3,5-diyne is sourced from PubChem (CID 14175237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).