About 1-chloro-4-(2,2-dimethoxyethylsulfanyl)benzene
1-chloro-4-(2,2-dimethoxyethylsulfanyl)benzene (PubChem CID 14175759) has the molecular formula C10H13ClO2S
and a molecular weight of 232.73 g/mol. Its IUPAC name is 1-chloro-4-(2,2-dimethoxyethylsulfanyl)benzene.
Molecular Properties
| Compound Name | 1-chloro-4-(2,2-dimethoxyethylsulfanyl)benzene |
| PubChem CID | 14175759 |
| Molecular Formula | C10H13ClO2S |
| Molecular Weight | 232.73 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 1-chloro-4-(2,2-dimethoxyethylsulfanyl)benzene |
| SMILES | COC(CSc1ccc(Cl)cc1)OC |
| InChI | InChI=1S/C10H13ClO2S/c1-12-10(13-2)7-14-9-5-3-8(11)4-6-9/h3-6,10H,7H2,1-2H3 |
| InChIKey | HGHXSASHYCILOM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.73 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-4-(2,2-dimethoxyethylsulfanyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-(2,2-dimethoxyethylsulfanyl)benzene?
The IUPAC name of 1-chloro-4-(2,2-dimethoxyethylsulfanyl)benzene (CID 14175759) is 1-chloro-4-(2,2-dimethoxyethylsulfanyl)benzene.
What is the SMILES notation for 1-chloro-4-(2,2-dimethoxyethylsulfanyl)benzene?
The canonical SMILES for 1-chloro-4-(2,2-dimethoxyethylsulfanyl)benzene is COC(CSc1ccc(Cl)cc1)OC.
What is the InChIKey of 1-chloro-4-(2,2-dimethoxyethylsulfanyl)benzene?
The InChIKey is HGHXSASHYCILOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClO2S/c1-12-10(13-2)7-14-9-5-3-8(11)4-6-9/h3-6,10H,7H2,1-2H3.
What are the key properties of 1-chloro-4-(2,2-dimethoxyethylsulfanyl)benzene?
1-chloro-4-(2,2-dimethoxyethylsulfanyl)benzene has a molecular weight of 232.73 g/mol, XLogP of 3.05, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-(2,2-dimethoxyethylsulfanyl)benzene is sourced from PubChem (CID 14175759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).