About methyl (4S,5S)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate
methyl (4S,5S)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 14176451) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is methyl (4S,5S)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate.
Analyze methyl (4S,5S)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4S,5S)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl (4S,5S)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate (CID 14176451) is methyl (4S,5S)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl (4S,5S)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl (4S,5S)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate is COC(=O)[C@H]1N=CO[C@H]1C.
What is the InChIKey of methyl (4S,5S)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The InChIKey is RAAGHFMDHMDDNX-WHFBIAKZSA-N. The full InChI is InChI=1S/C6H9NO3/c1-4-5(6(8)9-2)7-3-10-4/h3-5H,1-2H3/t4-,5-/m0/s1.
What are the key properties of methyl (4S,5S)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
methyl (4S,5S)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate has a molecular weight of 143.14 g/mol, XLogP of -0.03, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4S,5S)-5-methyl-4,5-dihydro-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 14176451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).