C15H14BrNO5 — CID 1417661
5-bromo-N-[(3,4-dimethoxyphenyl)methyl]-6-oxopyran-3-carboxamide (PubChem CID 1417661) has the molecular formula C15H14BrNO5 and a molecular weight of 368.18 g/mol. Its IUPAC name is 5-bromo-N-[(3,4-dimethoxyphenyl)methyl]-6-oxopyran-3-carboxamide.
| Compound Name | 5-bromo-N-[(3,4-dimethoxyphenyl)methyl]-6-oxopyran-3-carboxamide |
|---|---|
| PubChem CID | 1417661 |
| Molecular Formula | C15H14BrNO5 |
| Molecular Weight | 368.18 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 5-bromo-N-[(3,4-dimethoxyphenyl)methyl]-6-oxopyran-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2coc(=O)c(Br)c2)cc1OC |
| InChI | InChI=1S/C15H14BrNO5/c1-20-12-4-3-9(5-13(12)21-2)7-17-14(18)10-6-11(16)15(19)22-8-10/h3-6,8H,7H2,1-2H3,(H,17,18) |
| InChIKey | OWGMQCGHSJGMFM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.18 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |