C10H14N2 — CID 14177029
1,4,6-trimethyl-2,3-dihydropyrrolo[2,3-b]pyridine (PubChem CID 14177029) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 1,4,6-trimethyl-2,3-dihydropyrrolo[2,3-b]pyridine.
| Compound Name | 1,4,6-trimethyl-2,3-dihydropyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 14177029 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1,4,6-trimethyl-2,3-dihydropyrrolo[2,3-b]pyridine |
| SMILES | Cc1cc(C)c2c(n1)N(C)CC2 |
| InChI | InChI=1S/C10H14N2/c1-7-6-8(2)11-10-9(7)4-5-12(10)3/h6H,4-5H2,1-3H3 |
| InChIKey | FNUIFYSYAAXGNT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |