C10H10Cl2N6O4 — CID 14177471
2-chloro-4-[2-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]ethoxy]-6-methoxy-1,3,5-triazine (PubChem CID 14177471) has the molecular formula C10H10Cl2N6O4 and a molecular weight of 349.13 g/mol. Its IUPAC name is 2-chloro-4-[2-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]ethoxy]-6-methoxy-1,3,5-triazine.
| Compound Name | 2-chloro-4-[2-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]ethoxy]-6-methoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 14177471 |
| Molecular Formula | C10H10Cl2N6O4 |
| Molecular Weight | 349.13 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 2-chloro-4-[2-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)oxy]ethoxy]-6-methoxy-1,3,5-triazine |
| SMILES | COc1nc(Cl)nc(OCCOc2nc(Cl)nc(OC)n2)n1 |
| InChI | InChI=1S/C10H10Cl2N6O4/c1-19-7-13-5(11)15-9(17-7)21-3-4-22-10-16-6(12)14-8(18-10)20-2/h3-4H2,1-2H3 |
| InChIKey | YWBFJGXGGWCSOV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 114.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.13 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|