C14H10F2N2O2 — CID 14177539
2,5-difluoro-4,6-bis(prop-2-enoxy)benzene-1,3-dicarbonitrile (PubChem CID 14177539) has the molecular formula C14H10F2N2O2 and a molecular weight of 276.24 g/mol. Its IUPAC name is 2,5-difluoro-4,6-bis(prop-2-enoxy)benzene-1,3-dicarbonitrile.
| Compound Name | 2,5-difluoro-4,6-bis(prop-2-enoxy)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 14177539 |
| Molecular Formula | C14H10F2N2O2 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2,5-difluoro-4,6-bis(prop-2-enoxy)benzene-1,3-dicarbonitrile |
| SMILES | C=CCOc1c(F)c(OCC=C)c(C#N)c(F)c1C#N |
| InChI | InChI=1S/C14H10F2N2O2/c1-3-5-19-13-9(7-17)11(15)10(8-18)14(12(13)16)20-6-4-2/h3-4H,1-2,5-6H2 |
| InChIKey | GWSWQRDZLXFRQM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|