About 6-tert-butyl-3H-1,3-benzoxazole-2-thione
6-tert-butyl-3H-1,3-benzoxazole-2-thione (PubChem CID 14177714) has the molecular formula C11H13NOS
and a molecular weight of 207.30 g/mol. Its IUPAC name is 6-tert-butyl-3H-1,3-benzoxazole-2-thione.
Molecular Properties
| Compound Name | 6-tert-butyl-3H-1,3-benzoxazole-2-thione |
| PubChem CID | 14177714 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 6-tert-butyl-3H-1,3-benzoxazole-2-thione |
| SMILES | CC(C)(C)c1ccc2[nH]c(=S)oc2c1 |
| InChI | InChI=1S/C11H13NOS/c1-11(2,3)7-4-5-8-9(6-7)13-10(14)12-8/h4-6H,1-3H3,(H,12,14) |
| InChIKey | AOUAYGSFAYEABZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-tert-butyl-3H-1,3-benzoxazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-3H-1,3-benzoxazole-2-thione?
The IUPAC name of 6-tert-butyl-3H-1,3-benzoxazole-2-thione (CID 14177714) is 6-tert-butyl-3H-1,3-benzoxazole-2-thione.
What is the SMILES notation for 6-tert-butyl-3H-1,3-benzoxazole-2-thione?
The canonical SMILES for 6-tert-butyl-3H-1,3-benzoxazole-2-thione is CC(C)(C)c1ccc2[nH]c(=S)oc2c1.
What is the InChIKey of 6-tert-butyl-3H-1,3-benzoxazole-2-thione?
The InChIKey is AOUAYGSFAYEABZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NOS/c1-11(2,3)7-4-5-8-9(6-7)13-10(14)12-8/h4-6H,1-3H3,(H,12,14).
What are the key properties of 6-tert-butyl-3H-1,3-benzoxazole-2-thione?
6-tert-butyl-3H-1,3-benzoxazole-2-thione has a molecular weight of 207.30 g/mol, XLogP of 3.79, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-3H-1,3-benzoxazole-2-thione is sourced from PubChem (CID 14177714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).