C17H14N2O3S3 — CID 1417803
N-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-4-methylbenzenesulfonamide (PubChem CID 1417803) has the molecular formula C17H14N2O3S3 and a molecular weight of 390.51 g/mol. Its IUPAC name is N-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 1417803 |
| Molecular Formula | C17H14N2O3S3 |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | N-(5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NN2C(=O)C(=Cc3ccccc3)SC2=S)cc1 |
| InChI | InChI=1S/C17H14N2O3S3/c1-12-7-9-14(10-8-12)25(21,22)18-19-16(20)15(24-17(19)23)11-13-5-3-2-4-6-13/h2-11,18H,1H3 |
| InChIKey | FEFIBWBSMBJQSW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|