About 2-(4,4,4-trifluorobutyl)isoquinolin-2-ium iodide
2-(4,4,4-trifluorobutyl)isoquinolin-2-ium iodide (PubChem CID 14178034) has the molecular formula C13H13F3IN
and a molecular weight of 367.15 g/mol. Its IUPAC name is 2-(4,4,4-trifluorobutyl)isoquinolin-2-ium iodide.
Molecular Properties
| Compound Name | 2-(4,4,4-trifluorobutyl)isoquinolin-2-ium iodide |
| PubChem CID | 14178034 |
| Molecular Formula | C13H13F3IN |
| Molecular Weight | 367.15 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | 2-(4,4,4-trifluorobutyl)isoquinolin-2-ium iodide |
| SMILES | FC(F)(F)CCC[n+]1ccc2ccccc2c1.[I-] |
| InChI | InChI=1S/C13H13F3N.HI/c14-13(15,16)7-3-8-17-9-6-11-4-1-2-5-12(11)10-17;/h1-2,4-6,9-10H,3,7-8H2;1H/q+1;/p-1 |
| InChIKey | UDEGJUCJMRXAJN-UHFFFAOYSA-M |
| XLogP | 0.47 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.15 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4,4-trifluorobutyl)isoquinolin-2-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4,4-trifluorobutyl)isoquinolin-2-ium iodide?
The IUPAC name of 2-(4,4,4-trifluorobutyl)isoquinolin-2-ium iodide (CID 14178034) is 2-(4,4,4-trifluorobutyl)isoquinolin-2-ium iodide.
What is the SMILES notation for 2-(4,4,4-trifluorobutyl)isoquinolin-2-ium iodide?
The canonical SMILES for 2-(4,4,4-trifluorobutyl)isoquinolin-2-ium iodide is FC(F)(F)CCC[n+]1ccc2ccccc2c1.[I-].
What is the InChIKey of 2-(4,4,4-trifluorobutyl)isoquinolin-2-ium iodide?
The InChIKey is UDEGJUCJMRXAJN-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H13F3N.HI/c14-13(15,16)7-3-8-17-9-6-11-4-1-2-5-12(11)10-17;/h1-2,4-6,9-10H,3,7-8H2;1H/q+1;/p-1.
What are the key properties of 2-(4,4,4-trifluorobutyl)isoquinolin-2-ium iodide?
2-(4,4,4-trifluorobutyl)isoquinolin-2-ium iodide has a molecular weight of 367.15 g/mol, XLogP of 0.47, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4,4-trifluorobutyl)isoquinolin-2-ium iodide is sourced from PubChem (CID 14178034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).