About 4-cyano-N-decylbenzamide
4-cyano-N-decylbenzamide (PubChem CID 14179073) has the molecular formula C18H26N2O
and a molecular weight of 286.42 g/mol. Its IUPAC name is 4-cyano-N-decylbenzamide.
Molecular Properties
| Compound Name | 4-cyano-N-decylbenzamide |
| PubChem CID | 14179073 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 4-cyano-N-decylbenzamide |
| SMILES | CCCCCCCCCCNC(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H26N2O/c1-2-3-4-5-6-7-8-9-14-20-18(21)17-12-10-16(15-19)11-13-17/h10-13H,2-9,14H2,1H3,(H,20,21) |
| InChIKey | FTNQLBBIKRUMQE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-cyano-N-decylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-N-decylbenzamide?
The IUPAC name of 4-cyano-N-decylbenzamide (CID 14179073) is 4-cyano-N-decylbenzamide.
What is the SMILES notation for 4-cyano-N-decylbenzamide?
The canonical SMILES for 4-cyano-N-decylbenzamide is CCCCCCCCCCNC(=O)c1ccc(C#N)cc1.
What is the InChIKey of 4-cyano-N-decylbenzamide?
The InChIKey is FTNQLBBIKRUMQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2O/c1-2-3-4-5-6-7-8-9-14-20-18(21)17-12-10-16(15-19)11-13-17/h10-13H,2-9,14H2,1H3,(H,20,21).
What are the key properties of 4-cyano-N-decylbenzamide?
4-cyano-N-decylbenzamide has a molecular weight of 286.42 g/mol, XLogP of 4.43, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-N-decylbenzamide is sourced from PubChem (CID 14179073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).