About 10-(3-hydroxyprop-1-ynyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol
10-(3-hydroxyprop-1-ynyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol (PubChem CID 14181385) has the molecular formula C14H14N2O2
and a molecular weight of 242.28 g/mol. Its IUPAC name is 10-(3-hydroxyprop-1-ynyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol.
Molecular Properties
| Compound Name | 10-(3-hydroxyprop-1-ynyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol |
| PubChem CID | 14181385 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 10-(3-hydroxyprop-1-ynyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol |
| SMILES | OCC#CC1(O)C2=NCCCN2c2ccccc21 |
| InChI | InChI=1S/C14H14N2O2/c17-10-3-7-14(18)11-5-1-2-6-12(11)16-9-4-8-15-13(14)16/h1-2,5-6,17-18H,4,8-10H2 |
| InChIKey | OCVKCUCOLKVWAL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 10-(3-hydroxyprop-1-ynyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(3-hydroxyprop-1-ynyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol?
The IUPAC name of 10-(3-hydroxyprop-1-ynyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol (CID 14181385) is 10-(3-hydroxyprop-1-ynyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol.
What is the SMILES notation for 10-(3-hydroxyprop-1-ynyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol?
The canonical SMILES for 10-(3-hydroxyprop-1-ynyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol is OCC#CC1(O)C2=NCCCN2c2ccccc21.
What is the InChIKey of 10-(3-hydroxyprop-1-ynyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol?
The InChIKey is OCVKCUCOLKVWAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O2/c17-10-3-7-14(18)11-5-1-2-6-12(11)16-9-4-8-15-13(14)16/h1-2,5-6,17-18H,4,8-10H2.
What are the key properties of 10-(3-hydroxyprop-1-ynyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol?
10-(3-hydroxyprop-1-ynyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol has a molecular weight of 242.28 g/mol, XLogP of 0.49, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(3-hydroxyprop-1-ynyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol is sourced from PubChem (CID 14181385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).