About 10-(3-methoxybutyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol
10-(3-methoxybutyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol (PubChem CID 14181398) has the molecular formula C16H22N2O2
and a molecular weight of 274.36 g/mol. Its IUPAC name is 10-(3-methoxybutyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol.
Molecular Properties
| Compound Name | 10-(3-methoxybutyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol |
| PubChem CID | 14181398 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 10-(3-methoxybutyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol |
| SMILES | COC(C)CCC1(O)C2=NCCCN2c2ccccc21 |
| InChI | InChI=1S/C16H22N2O2/c1-12(20-2)8-9-16(19)13-6-3-4-7-14(13)18-11-5-10-17-15(16)18/h3-4,6-7,12,19H,5,8-11H2,1-2H3 |
| InChIKey | SCEHWPMLDBOIGZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10-(3-methoxybutyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(3-methoxybutyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol?
The IUPAC name of 10-(3-methoxybutyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol (CID 14181398) is 10-(3-methoxybutyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol.
What is the SMILES notation for 10-(3-methoxybutyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol?
The canonical SMILES for 10-(3-methoxybutyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol is COC(C)CCC1(O)C2=NCCCN2c2ccccc21.
What is the InChIKey of 10-(3-methoxybutyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol?
The InChIKey is SCEHWPMLDBOIGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O2/c1-12(20-2)8-9-16(19)13-6-3-4-7-14(13)18-11-5-10-17-15(16)18/h3-4,6-7,12,19H,5,8-11H2,1-2H3.
What are the key properties of 10-(3-methoxybutyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol?
10-(3-methoxybutyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol has a molecular weight of 274.36 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(3-methoxybutyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol is sourced from PubChem (CID 14181398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).