C15H22ClNO3 — CID 14181476
methyl 1-[(4-methoxyphenyl)methyl]piperidine-3-carboxylate;hydrochloride (PubChem CID 14181476) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is methyl 1-[(4-methoxyphenyl)methyl]piperidine-3-carboxylate;hydrochloride.
| Compound Name | methyl 1-[(4-methoxyphenyl)methyl]piperidine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 14181476 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | methyl 1-[(4-methoxyphenyl)methyl]piperidine-3-carboxylate;hydrochloride |
| SMILES | COC(=O)C1CCCN(Cc2ccc(OC)cc2)C1.Cl |
| InChI | InChI=1S/C15H21NO3.ClH/c1-18-14-7-5-12(6-8-14)10-16-9-3-4-13(11-16)15(17)19-2;/h5-8,13H,3-4,9-11H2,1-2H3;1H |
| InChIKey | JMGBPSBIQDHRNU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |