C9H14Br4O — CID 14181811
5,7,7,7-tetrabromo-4,4-dimethylheptan-2-one (PubChem CID 14181811) has the molecular formula C9H14Br4O and a molecular weight of 457.83 g/mol. Its IUPAC name is 5,7,7,7-tetrabromo-4,4-dimethylheptan-2-one.
| Compound Name | 5,7,7,7-tetrabromo-4,4-dimethylheptan-2-one |
|---|---|
| PubChem CID | 14181811 |
| Molecular Formula | C9H14Br4O |
| Molecular Weight | 457.83 g/mol |
| Exact Mass | 453.78 |
| IUPAC Name | 5,7,7,7-tetrabromo-4,4-dimethylheptan-2-one |
| SMILES | CC(=O)CC(C)(C)C(Br)CC(Br)(Br)Br |
| InChI | InChI=1S/C9H14Br4O/c1-6(14)4-8(2,3)7(10)5-9(11,12)13/h7H,4-5H2,1-3H3 |
| InChIKey | STFWGKXNMIMEKX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.83 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|