4-chloro-2,2-dimethyl-3-oxobutanoyl chloride

C6H8Cl2O2 — CID 14181858

IUPAC4-chloro-2,2-dimethyl-3-oxobutanoyl chloride
SMILESCC(C)(C(=O)Cl)C(=O)CCl
InChIInChI=1S/C6H8Cl2O2/c1-6(2,5(8)10)4(9)3-7/h3H2,1-2H3
InChIKeyHUXMABLWLOCNPZ-UHFFFAOYSA-N
MW183.03 g/mol
LogP1.59
Rot. Bonds3

About 4-chloro-2,2-dimethyl-3-oxobutanoyl chloride

4-chloro-2,2-dimethyl-3-oxobutanoyl chloride (PubChem CID 14181858) has the molecular formula C6H8Cl2O2 and a molecular weight of 183.03 g/mol. Its IUPAC name is 4-chloro-2,2-dimethyl-3-oxobutanoyl chloride.

Molecular Properties

Compound Name4-chloro-2,2-dimethyl-3-oxobutanoyl chloride
PubChem CID14181858
Molecular FormulaC6H8Cl2O2
Molecular Weight183.03 g/mol
Exact Mass181.99
IUPAC Name4-chloro-2,2-dimethyl-3-oxobutanoyl chloride
SMILESCC(C)(C(=O)Cl)C(=O)CCl
InChIInChI=1S/C6H8Cl2O2/c1-6(2,5(8)10)4(9)3-7/h3H2,1-2H3
InChIKeyHUXMABLWLOCNPZ-UHFFFAOYSA-N
XLogP1.59
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.03
LogP ≤ 51.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 4-chloro-2,2-dimethyl-3-oxobutanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-chloro-2,2-dimethyl-3-oxobutanoyl chloride?
The IUPAC name of 4-chloro-2,2-dimethyl-3-oxobutanoyl chloride (CID 14181858) is 4-chloro-2,2-dimethyl-3-oxobutanoyl chloride.
What is the SMILES notation for 4-chloro-2,2-dimethyl-3-oxobutanoyl chloride?
The canonical SMILES for 4-chloro-2,2-dimethyl-3-oxobutanoyl chloride is CC(C)(C(=O)Cl)C(=O)CCl.
What is the InChIKey of 4-chloro-2,2-dimethyl-3-oxobutanoyl chloride?
The InChIKey is HUXMABLWLOCNPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Cl2O2/c1-6(2,5(8)10)4(9)3-7/h3H2,1-2H3.
What are the key properties of 4-chloro-2,2-dimethyl-3-oxobutanoyl chloride?
4-chloro-2,2-dimethyl-3-oxobutanoyl chloride has a molecular weight of 183.03 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,2-dimethyl-3-oxobutanoyl chloride is sourced from PubChem (CID 14181858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).