C18H18Cl2F4O2 — CID 14181900
[4-[(E)-2,3-dichloroprop-2-enyl]-2,3,5,6-tetrafluorophenyl]methyl 2,2,3,3-tetramethylcyclopropane-1-carboxylate (PubChem CID 14181900) has the molecular formula C18H18Cl2F4O2 and a molecular weight of 413.24 g/mol. Its IUPAC name is [4-[(E)-2,3-dichloroprop-2-enyl]-2,3,5,6-tetrafluorophenyl]methyl 2,2,3,3-tetramethylcyclopropane-1-carboxylate.
| Compound Name | [4-[(E)-2,3-dichloroprop-2-enyl]-2,3,5,6-tetrafluorophenyl]methyl 2,2,3,3-tetramethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 14181900 |
| Molecular Formula | C18H18Cl2F4O2 |
| Molecular Weight | 413.24 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | [4-[(E)-2,3-dichloroprop-2-enyl]-2,3,5,6-tetrafluorophenyl]methyl 2,2,3,3-tetramethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)C(C(=O)OCc2c(F)c(F)c(C/C(Cl)=C\Cl)c(F)c2F)C1(C)C |
| InChI | InChI=1S/C18H18Cl2F4O2/c1-17(2)15(18(17,3)4)16(25)26-7-10-13(23)11(21)9(5-8(20)6-19)12(22)14(10)24/h6,15H,5,7H2,1-4H3/b8-6+ |
| InChIKey | FHSYQQWFURYXFQ-SOFGYWHQSA-N |
| XLogP | 5.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.24 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|