C26H38O4S — CID 14182666
methyl (2E,4S)-7-(oxan-2-yloxy)-1-phenylsulfanyl-4-propan-2-ylcyclodec-2-ene-1-carboxylate (PubChem CID 14182666) has the molecular formula C26H38O4S and a molecular weight of 446.65 g/mol. Its IUPAC name is methyl (2E,4S)-7-(oxan-2-yloxy)-1-phenylsulfanyl-4-propan-2-ylcyclodec-2-ene-1-carboxylate.
| Compound Name | methyl (2E,4S)-7-(oxan-2-yloxy)-1-phenylsulfanyl-4-propan-2-ylcyclodec-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 14182666 |
| Molecular Formula | C26H38O4S |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | methyl (2E,4S)-7-(oxan-2-yloxy)-1-phenylsulfanyl-4-propan-2-ylcyclodec-2-ene-1-carboxylate |
| SMILES | COC(=O)C1(Sc2ccccc2)/C=C/[C@H](C(C)C)CCC(OC2CCCCO2)CCC1 |
| InChI | InChI=1S/C26H38O4S/c1-20(2)21-14-15-22(30-24-13-7-8-19-29-24)10-9-17-26(18-16-21,25(27)28-3)31-23-11-5-4-6-12-23/h4-6,11-12,16,18,20-22,24H,7-10,13-15,17,19H2,1-3H3/b18-16+/t21-,22?,24?,26?/m1/s1 |
| InChIKey | XSWWVSVBSLWRMJ-SXRVXDLASA-N |
| XLogP | 6.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|