C34H37N3O6S — CID 14183177
(Z)-but-2-enedioic acid;N-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(4-phenacylpiperazin-1-yl)butanamide (PubChem CID 14183177) has the molecular formula C34H37N3O6S and a molecular weight of 615.75 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(4-phenacylpiperazin-1-yl)butanamide.
| Compound Name | (Z)-but-2-enedioic acid;N-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(4-phenacylpiperazin-1-yl)butanamide |
|---|---|
| PubChem CID | 14183177 |
| Molecular Formula | C34H37N3O6S |
| Molecular Weight | 615.75 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-(6,11-dihydrobenzo[c][1]benzothiepin-11-yl)-4-(4-phenacylpiperazin-1-yl)butanamide |
| SMILES | O=C(CCCN1CCN(CC(=O)c2ccccc2)CC1)NC1c2ccccc2CSc2ccccc21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C30H33N3O2S.C4H4O4/c34-27(23-9-2-1-3-10-23)21-33-19-17-32(18-20-33)16-8-15-29(35)31-30-25-12-5-4-11-24(25)22-36-28-14-7-6-13-26(28)30;5-3(6)1-2-4(7)8/h1-7,9-14,30H,8,15-22H2,(H,31,35);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | FIVPNJXOYHBUOQ-BTJKTKAUSA-N |
| XLogP | 4.49 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.75 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|