C19H21NO2 — CID 14183693
2-hydroxy-6-(4-phenylbutyl)-3,4-dihydroisoquinolin-1-one (PubChem CID 14183693) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-hydroxy-6-(4-phenylbutyl)-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-hydroxy-6-(4-phenylbutyl)-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 14183693 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-hydroxy-6-(4-phenylbutyl)-3,4-dihydroisoquinolin-1-one |
| SMILES | O=C1c2ccc(CCCCc3ccccc3)cc2CCN1O |
| InChI | InChI=1S/C19H21NO2/c21-19-18-11-10-16(14-17(18)12-13-20(19)22)9-5-4-8-15-6-2-1-3-7-15/h1-3,6-7,10-11,14,22H,4-5,8-9,12-13H2 |
| InChIKey | CSMFVDUQGIWIFR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|