C10H9N5O2 — CID 14185409
3,5-dimethyl-8-nitro-1,6-dihydropyrazolo[4,3-f]indazole (PubChem CID 14185409) has the molecular formula C10H9N5O2 and a molecular weight of 231.22 g/mol. Its IUPAC name is 3,5-dimethyl-8-nitro-1,6-dihydropyrazolo[4,3-f]indazole.
| Compound Name | 3,5-dimethyl-8-nitro-1,6-dihydropyrazolo[4,3-f]indazole |
|---|---|
| PubChem CID | 14185409 |
| Molecular Formula | C10H9N5O2 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 3,5-dimethyl-8-nitro-1,6-dihydropyrazolo[4,3-f]indazole |
| SMILES | Cc1[nH]nc2c([N+](=O)[O-])c3[nH]nc(C)c3cc12 |
| InChI | InChI=1S/C10H9N5O2/c1-4-6-3-7-5(2)12-14-9(7)10(15(16)17)8(6)13-11-4/h3H,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | SJGRLFUUACZQRA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|