C11H24OSi2 — CID 14185812
(1E,4E)-1,5-bis(trimethylsilyl)penta-1,4-dien-3-ol (PubChem CID 14185812) has the molecular formula C11H24OSi2 and a molecular weight of 228.48 g/mol. Its IUPAC name is (1E,4E)-1,5-bis(trimethylsilyl)penta-1,4-dien-3-ol.
| Compound Name | (1E,4E)-1,5-bis(trimethylsilyl)penta-1,4-dien-3-ol |
|---|---|
| PubChem CID | 14185812 |
| Molecular Formula | C11H24OSi2 |
| Molecular Weight | 228.48 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (1E,4E)-1,5-bis(trimethylsilyl)penta-1,4-dien-3-ol |
| SMILES | C[Si](C)(C)/C=C/C(O)/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C11H24OSi2/c1-13(2,3)9-7-11(12)8-10-14(4,5)6/h7-12H,1-6H3/b9-7+,10-8+ |
| InChIKey | GXKZSUXGJRNSHX-FIFLTTCUSA-N |
| XLogP | 3.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|