C21H44O2Sn — CID 14185832
(E,3R,4S)-1-tributylstannylnon-1-ene-3,4-diol (PubChem CID 14185832) has the molecular formula C21H44O2Sn and a molecular weight of 447.29 g/mol. Its IUPAC name is (E,3R,4S)-1-tributylstannylnon-1-ene-3,4-diol.
| Compound Name | (E,3R,4S)-1-tributylstannylnon-1-ene-3,4-diol |
|---|---|
| PubChem CID | 14185832 |
| Molecular Formula | C21H44O2Sn |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | (E,3R,4S)-1-tributylstannylnon-1-ene-3,4-diol |
| SMILES | CCCCC[C@H](O)[C@H](O)/C=C/[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C9H17O2.3C4H9.Sn/c1-3-5-6-7-9(11)8(10)4-2;3*1-3-4-2;/h2,4,8-11H,3,5-7H2,1H3;3*1,3-4H2,2H3;/t8-,9+;;;;/m1..../s1 |
| InChIKey | FGNBYAONEOVQMI-UKTYMXBTSA-N |
| XLogP | 6.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|