C6H12N2O6S — CID 14186149
3-amino-4-oxo-4-(2-sulfoethylamino)butanoic acid (PubChem CID 14186149) has the molecular formula C6H12N2O6S and a molecular weight of 240.24 g/mol. Its IUPAC name is 3-amino-4-oxo-4-(2-sulfoethylamino)butanoic acid.
| Compound Name | 3-amino-4-oxo-4-(2-sulfoethylamino)butanoic acid |
|---|---|
| PubChem CID | 14186149 |
| Molecular Formula | C6H12N2O6S |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 3-amino-4-oxo-4-(2-sulfoethylamino)butanoic acid |
| SMILES | NC(CC(=O)O)C(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C6H12N2O6S/c7-4(3-5(9)10)6(11)8-1-2-15(12,13)14/h4H,1-3,7H2,(H,8,11)(H,9,10)(H,12,13,14) |
| InChIKey | VYZDHIGWWYERJI-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|