C23H27NO3 — CID 14186449
4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoic acid (PubChem CID 14186449) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is 4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoic acid.
| Compound Name | 4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 14186449 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 4-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoic acid |
| SMILES | Cc1cc2c(cc1NC(=O)c1ccc(C(=O)O)cc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H27NO3/c1-14-12-17-18(23(4,5)11-10-22(17,2)3)13-19(14)24-20(25)15-6-8-16(9-7-15)21(26)27/h6-9,12-13H,10-11H2,1-5H3,(H,24,25)(H,26,27) |
| InChIKey | PMVPBNHYUQQVEK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |