C14H24O2Si — CID 14189022
4-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enylcyclopent-2-en-1-one (PubChem CID 14189022) has the molecular formula C14H24O2Si and a molecular weight of 252.43 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enylcyclopent-2-en-1-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 14189022 |
| Molecular Formula | C14H24O2Si |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-prop-2-enylcyclopent-2-en-1-one |
| SMILES | C=CCC1=CC(O[Si](C)(C)C(C)(C)C)CC1=O |
| InChI | InChI=1S/C14H24O2Si/c1-7-8-11-9-12(10-13(11)15)16-17(5,6)14(2,3)4/h7,9,12H,1,8,10H2,2-6H3 |
| InChIKey | PBMVKTMQXGLJNA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|