C20H24O11 — CID 14190702
[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 11-ethyl-12-oxo-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradeca-2,5-diene-5-carboxylate (PubChem CID 14190702) has the molecular formula C20H24O11 and a molecular weight of 440.40 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 11-ethyl-12-oxo-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradeca-2,5-diene-5-carboxylate.
| Compound Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 11-ethyl-12-oxo-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradeca-2,5-diene-5-carboxylate |
|---|---|
| PubChem CID | 14190702 |
| Molecular Formula | C20H24O11 |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 11-ethyl-12-oxo-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradeca-2,5-diene-5-carboxylate |
| SMILES | CCC1C(=O)OC23C=CC4C(C(=O)OC5OC(CO)C(O)C(O)C5O)=COC(OC12)C43 |
| InChI | InChI=1S/C20H24O11/c1-2-7-15-20(31-17(7)26)4-3-8-9(6-27-18(29-15)11(8)20)16(25)30-19-14(24)13(23)12(22)10(5-21)28-19/h3-4,6-8,10-15,18-19,21-24H,2,5H2,1H3 |
| InChIKey | DGNUDTLXTAPNCX-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 161.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|